C20H33N9O7S — CID 71042796
(2S,3S,4R,5R)-5-[6-amino-2-[2-[6-(methanesulfonamido)hexanoylamino]ethylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide (PubChem CID 71042796) has the molecular formula C20H33N9O7S and a molecular weight of 543.61 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-amino-2-[2-[6-(methanesulfonamido)hexanoylamino]ethylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-amino-2-[2-[6-(methanesulfonamido)hexanoylamino]ethylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 71042796 |
| Molecular Formula | C20H33N9O7S |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-amino-2-[2-[6-(methanesulfonamido)hexanoylamino]ethylamino]purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
| SMILES | CNC(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(NCCNC(=O)CCCCCNS(C)(=O)=O)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H33N9O7S/c1-22-18(33)15-13(31)14(32)19(36-15)29-10-25-12-16(21)27-20(28-17(12)29)24-9-8-23-11(30)6-4-3-5-7-26-37(2,34)35/h10,13-15,19,26,31-32H,3-9H2,1-2H3,(H,22,33)(H,23,30)(H3,21,24,27,28)/t13-,14+,15-,19+/m0/s1 |
| InChIKey | UCHVQEUGSBDJLD-QCUYGVNKSA-N |
| XLogP | -2.59 |
| TPSA | 235.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|