C26H43N9O9S — CID 157124673
(2S)-2-amino-4-[[(2S,3S,4R,5R)-5-[6-amino-2-[2-(7-methylsulfonylheptanoylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolane-2-carbonyl]-ethylamino]butanoic acid (PubChem CID 157124673) has the molecular formula C26H43N9O9S and a molecular weight of 657.75 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-[6-amino-2-[2-(7-methylsulfonylheptanoylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolane-2-carbonyl]-ethylamino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-[6-amino-2-[2-(7-methylsulfonylheptanoylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolane-2-carbonyl]-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 157124673 |
| Molecular Formula | C26H43N9O9S |
| Molecular Weight | 657.75 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-[6-amino-2-[2-(7-methylsulfonylheptanoylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolane-2-carbonyl]-ethylamino]butanoic acid |
| SMILES | CCN(CC[C@H](N)C(=O)O)C(=O)[C@H]1O[C@@H](n2cnc3c(N)nc(NCCNC(=O)CCCCCCS(C)(=O)=O)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H43N9O9S/c1-3-34(12-9-15(27)25(40)41)23(39)20-18(37)19(38)24(44-20)35-14-31-17-21(28)32-26(33-22(17)35)30-11-10-29-16(36)8-6-4-5-7-13-45(2,42)43/h14-15,18-20,24,37-38H,3-13,27H2,1-2H3,(H,29,36)(H,40,41)(H3,28,30,32,33)/t15-,18-,19+,20-,24+/m0/s1 |
| InChIKey | PAHQQFYBPODTQL-ZZPIQPOASA-N |
| XLogP | -1.80 |
| TPSA | 278.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.75 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|