C20H32N8O7S — CID 157295323
(2S,3S,4R,5R)-5-[6-amino-2-[2-(7-methylsulfonylheptanoylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 157295323) has the molecular formula C20H32N8O7S and a molecular weight of 528.59 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-amino-2-[2-(7-methylsulfonylheptanoylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-amino-2-[2-(7-methylsulfonylheptanoylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 157295323 |
| Molecular Formula | C20H32N8O7S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-amino-2-[2-(7-methylsulfonylheptanoylamino)ethylamino]purin-9-yl]-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CS(=O)(=O)CCCCCCC(=O)NCCNc1nc(N)c2ncn([C@@H]3O[C@H](C(N)=O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C20H32N8O7S/c1-36(33,34)9-5-3-2-4-6-11(29)23-7-8-24-20-26-16(21)12-18(27-20)28(10-25-12)19-14(31)13(30)15(35-19)17(22)32/h10,13-15,19,30-31H,2-9H2,1H3,(H2,22,32)(H,23,29)(H3,21,24,26,27)/t13-,14+,15-,19+/m0/s1 |
| InChIKey | MRDLXMCBDUYULM-QCUYGVNKSA-N |
| XLogP | -1.96 |
| TPSA | 237.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|