C17H24N5O6P — CID 174019619
[(2R,5R)-5-(6-aminopurin-9-yl)-2-(methoxymethyl)-4-prop-2-ynoxyoxolan-3-yl]oxy-propan-2-ylphosphinic acid (PubChem CID 174019619) has the molecular formula C17H24N5O6P and a molecular weight of 425.38 g/mol. Its IUPAC name is [(2R,5R)-5-(6-aminopurin-9-yl)-2-(methoxymethyl)-4-prop-2-ynoxyoxolan-3-yl]oxy-propan-2-ylphosphinic acid.
| Compound Name | [(2R,5R)-5-(6-aminopurin-9-yl)-2-(methoxymethyl)-4-prop-2-ynoxyoxolan-3-yl]oxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 174019619 |
| Molecular Formula | C17H24N5O6P |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [(2R,5R)-5-(6-aminopurin-9-yl)-2-(methoxymethyl)-4-prop-2-ynoxyoxolan-3-yl]oxy-propan-2-ylphosphinic acid |
| SMILES | C#CCOC1C(OP(=O)(O)C(C)C)[C@@H](COC)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C17H24N5O6P/c1-5-6-26-14-13(28-29(23,24)10(2)3)11(7-25-4)27-17(14)22-9-21-12-15(18)19-8-20-16(12)22/h1,8-11,13-14,17H,6-7H2,2-4H3,(H,23,24)(H2,18,19,20)/t11-,13?,14?,17-/m1/s1 |
| InChIKey | JIAKHDLSKCMIMP-PKNZVCHQSA-N |
| XLogP | 0.95 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|