C13H23N5O15P4 — CID 167019035
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[[hydroxy-[hydroxy-[hydroxy(methoxy)phosphoryl]oxyphosphoryl]oxyphosphoryl]oxymethyl]-4-methoxyoxolan-3-yl]oxy-methylphosphinic acid (PubChem CID 167019035) has the molecular formula C13H23N5O15P4 and a molecular weight of 613.24 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[[hydroxy-[hydroxy-[hydroxy(methoxy)phosphoryl]oxyphosphoryl]oxyphosphoryl]oxymethyl]-4-methoxyoxolan-3-yl]oxy-methylphosphinic acid.
| Compound Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[[hydroxy-[hydroxy-[hydroxy(methoxy)phosphoryl]oxyphosphoryl]oxyphosphoryl]oxymethyl]-4-methoxyoxolan-3-yl]oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 167019035 |
| Molecular Formula | C13H23N5O15P4 |
| Molecular Weight | 613.24 g/mol |
| Exact Mass | 613.01 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-2-[[hydroxy-[hydroxy-[hydroxy(methoxy)phosphoryl]oxyphosphoryl]oxyphosphoryl]oxymethyl]-4-methoxyoxolan-3-yl]oxy-methylphosphinic acid |
| SMILES | CO[C@@H]1[C@H](OP(C)(=O)O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)OC)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C13H23N5O15P4/c1-27-10-9(31-34(3,19)20)7(4-29-36(23,24)33-37(25,26)32-35(21,22)28-2)30-13(10)18-6-17-8-11(14)15-5-16-12(8)18/h5-7,9-10,13H,4H2,1-3H3,(H,19,20)(H,21,22)(H,23,24)(H,25,26)(H2,14,15,16)/t7-,9-,10-,13-/m1/s1 |
| InChIKey | CNKNYIHNEWFDAR-QYVSTXNMSA-N |
| XLogP | 0.52 |
| TPSA | 283.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|