C12H16N5O4P — CID 50900871
[(1S,2S,4R,5R)-4-(6-aminopurin-9-yl)-2-bicyclo[3.1.0]hexanyl]oxymethylphosphonic acid (PubChem CID 50900871) has the molecular formula C12H16N5O4P and a molecular weight of 325.27 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-4-(6-aminopurin-9-yl)-2-bicyclo[3.1.0]hexanyl]oxymethylphosphonic acid.
| Compound Name | [(1S,2S,4R,5R)-4-(6-aminopurin-9-yl)-2-bicyclo[3.1.0]hexanyl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 50900871 |
| Molecular Formula | C12H16N5O4P |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | [(1S,2S,4R,5R)-4-(6-aminopurin-9-yl)-2-bicyclo[3.1.0]hexanyl]oxymethylphosphonic acid |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C[C@H](OCP(=O)(O)O)[C@H]2C[C@H]21 |
| InChI | InChI=1S/C12H16N5O4P/c13-11-10-12(15-3-14-11)17(4-16-10)8-2-9(7-1-6(7)8)21-5-22(18,19)20/h3-4,6-9H,1-2,5H2,(H2,13,14,15)(H2,18,19,20)/t6-,7+,8-,9+/m1/s1 |
| InChIKey | URWWZMYUWJSOQU-XAVMHZPKSA-N |
| XLogP | 0.51 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|