C10H14N5O5P — CID 137241002
[(3S)-4-(6-oxo-1H-purin-9-yl)pyrrolidin-3-yl]oxymethylphosphonic acid (PubChem CID 137241002) has the molecular formula C10H14N5O5P and a molecular weight of 315.23 g/mol. Its IUPAC name is [(3S)-4-(6-oxo-1H-purin-9-yl)pyrrolidin-3-yl]oxymethylphosphonic acid.
| Compound Name | [(3S)-4-(6-oxo-1H-purin-9-yl)pyrrolidin-3-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 137241002 |
| Molecular Formula | C10H14N5O5P |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | [(3S)-4-(6-oxo-1H-purin-9-yl)pyrrolidin-3-yl]oxymethylphosphonic acid |
| SMILES | O=c1[nH]cnc2c1ncn2C1CNC[C@@H]1OCP(=O)(O)O |
| InChI | InChI=1S/C10H14N5O5P/c16-10-8-9(12-3-13-10)15(4-14-8)6-1-11-2-7(6)20-5-21(17,18)19/h3-4,6-7,11H,1-2,5H2,(H,12,13,16)(H2,17,18,19)/t6?,7-/m0/s1 |
| InChIKey | YFBRPISOXMPUHB-MLWJPKLSSA-N |
| XLogP | -1.22 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|