C17H28N5O6P — CID 137240969
9-[(3R,4S)-4-[(2S)-2-di(propan-2-yloxy)phosphoryl-2-hydroxyethoxy]pyrrolidin-3-yl]-1H-purin-6-one (PubChem CID 137240969) has the molecular formula C17H28N5O6P and a molecular weight of 429.41 g/mol. Its IUPAC name is 9-[(3R,4S)-4-[(2S)-2-di(propan-2-yloxy)phosphoryl-2-hydroxyethoxy]pyrrolidin-3-yl]-1H-purin-6-one.
| Compound Name | 9-[(3R,4S)-4-[(2S)-2-di(propan-2-yloxy)phosphoryl-2-hydroxyethoxy]pyrrolidin-3-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137240969 |
| Molecular Formula | C17H28N5O6P |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 9-[(3R,4S)-4-[(2S)-2-di(propan-2-yloxy)phosphoryl-2-hydroxyethoxy]pyrrolidin-3-yl]-1H-purin-6-one |
| SMILES | CC(C)OP(=O)(OC(C)C)[C@H](O)CO[C@H]1CNC[C@H]1n1cnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C17H28N5O6P/c1-10(2)27-29(25,28-11(3)4)14(23)7-26-13-6-18-5-12(13)22-9-21-15-16(22)19-8-20-17(15)24/h8-14,18,23H,5-7H2,1-4H3,(H,19,20,24)/t12-,13+,14+/m1/s1 |
| InChIKey | NPAMFLVLRSZZHD-RDBSUJKOSA-N |
| XLogP | 1.01 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|