C10H13N4O6P — CID 137314788
[(3R,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxymethylphosphonic acid (PubChem CID 137314788) has the molecular formula C10H13N4O6P and a molecular weight of 316.21 g/mol. Its IUPAC name is [(3R,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxymethylphosphonic acid.
| Compound Name | [(3R,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 137314788 |
| Molecular Formula | C10H13N4O6P |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | [(3R,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxymethylphosphonic acid |
| SMILES | O=c1[nH]cnc2c1ncn2[C@H]1C[C@@H](OCP(=O)(O)O)CO1 |
| InChI | InChI=1S/C10H13N4O6P/c15-10-8-9(11-3-12-10)14(4-13-8)7-1-6(2-19-7)20-5-21(16,17)18/h3-4,6-7H,1-2,5H2,(H,11,12,15)(H2,16,17,18)/t6-,7-/m1/s1 |
| InChIKey | JZXZLBSOFFMZQE-RNFRBKRXSA-N |
| XLogP | -0.44 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|