C10H12N5Na2O5P — CID 11222102
disodium;9-[(2R,4R)-4-(phosphonatomethoxy)oxolan-2-yl]purin-6-amine (PubChem CID 11222102) has the molecular formula C10H12N5Na2O5P and a molecular weight of 359.19 g/mol. Its IUPAC name is disodium;9-[(2R,4R)-4-(phosphonatomethoxy)oxolan-2-yl]purin-6-amine.
| Compound Name | disodium;9-[(2R,4R)-4-(phosphonatomethoxy)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 11222102 |
| Molecular Formula | C10H12N5Na2O5P |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | disodium;9-[(2R,4R)-4-(phosphonatomethoxy)oxolan-2-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C[C@@H](OCP(=O)([O-])[O-])CO1.[Na+].[Na+] |
| InChI | InChI=1S/C10H14N5O5P.2Na/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-6(2-19-7)20-5-21(16,17)18;;/h3-4,6-7H,1-2,5H2,(H2,11,12,13)(H2,16,17,18);;/q;2*+1/p-2/t6-,7-;;/m1../s1 |
| InChIKey | OKBUPFIGWSCMKB-GPJOBVNKSA-L |
| XLogP | -7.41 |
| TPSA | 151.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | -7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|