C11H20N7O4P — CID 171628949
diazanium;9-[(1R,4S)-4-(phosphonatomethoxy)cyclopent-2-en-1-yl]purin-6-amine (PubChem CID 171628949) has the molecular formula C11H20N7O4P and a molecular weight of 345.30 g/mol. Its IUPAC name is diazanium;9-[(1R,4S)-4-(phosphonatomethoxy)cyclopent-2-en-1-yl]purin-6-amine.
| Compound Name | diazanium;9-[(1R,4S)-4-(phosphonatomethoxy)cyclopent-2-en-1-yl]purin-6-amine |
|---|---|
| PubChem CID | 171628949 |
| Molecular Formula | C11H20N7O4P |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | diazanium;9-[(1R,4S)-4-(phosphonatomethoxy)cyclopent-2-en-1-yl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@H]1C=C[C@@H](OCP(=O)([O-])[O-])C1.[NH4+].[NH4+] |
| InChI | InChI=1S/C11H14N5O4P.2H3N/c12-10-9-11(14-4-13-10)16(5-15-9)7-1-2-8(3-7)20-6-21(17,18)19;;/h1-2,4-5,7-8H,3,6H2,(H2,12,13,14)(H2,17,18,19);2*1H3/t7-,8+;;/m0../s1 |
| InChIKey | ZRTBHDHRXIXSAU-OXOJUWDDSA-N |
| XLogP | -0.08 |
| TPSA | 215.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|