C15H21N5O — CID 10827148
9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]purin-6-amine (PubChem CID 10827148) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]purin-6-amine.
| Compound Name | 9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]purin-6-amine |
|---|---|
| PubChem CID | 10827148 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 9-[(1S,4R)-4-[(2-methylpropan-2-yl)oxymethyl]cyclopent-2-en-1-yl]purin-6-amine |
| SMILES | CC(C)(C)OC[C@H]1C=C[C@@H](n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C15H21N5O/c1-15(2,3)21-7-10-4-5-11(6-10)20-9-19-12-13(16)17-8-18-14(12)20/h4-5,8-11H,6-7H2,1-3H3,(H2,16,17,18)/t10-,11+/m0/s1 |
| InChIKey | BJNLCNXBXIYYLG-WDEREUQCSA-N |
| XLogP | 2.34 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|