C31H37N6O6P — CID 11994438
methyl (2S)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate (PubChem CID 11994438) has the molecular formula C31H37N6O6P and a molecular weight of 620.65 g/mol. Its IUPAC name is methyl (2S)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 11994438 |
| Molecular Formula | C31H37N6O6P |
| Molecular Weight | 620.65 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | methyl (2S)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OC(C)(C)C)cc1)NP(=O)(OC[C@H]1C=C[C@@H](n2cnc3c(N)ncnc32)C1)Oc1ccccc1 |
| InChI | InChI=1S/C31H37N6O6P/c1-31(2,3)42-24-14-11-21(12-15-24)17-26(30(38)40-4)36-44(39,43-25-8-6-5-7-9-25)41-18-22-10-13-23(16-22)37-20-35-27-28(32)33-19-34-29(27)37/h5-15,19-20,22-23,26H,16-18H2,1-4H3,(H,36,39)(H2,32,33,34)/t22-,23+,26-,44?/m0/s1 |
| InChIKey | ULDAVOHHUWKMLL-SNWJBKKQSA-N |
| XLogP | 5.28 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|