C23H28N7O7P — CID 140508042
[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-3-methoxy-2-methyl-3-oxo-2-(phenylmethoxyamino)propanoyl]phosphonamidic acid (PubChem CID 140508042) has the molecular formula C23H28N7O7P and a molecular weight of 545.49 g/mol. Its IUPAC name is [(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-3-methoxy-2-methyl-3-oxo-2-(phenylmethoxyamino)propanoyl]phosphonamidic acid.
| Compound Name | [(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-3-methoxy-2-methyl-3-oxo-2-(phenylmethoxyamino)propanoyl]phosphonamidic acid |
|---|---|
| PubChem CID | 140508042 |
| Molecular Formula | C23H28N7O7P |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | [(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-N-[(2S)-3-methoxy-2-methyl-3-oxo-2-(phenylmethoxyamino)propanoyl]phosphonamidic acid |
| SMILES | COC(=O)[C@@](C)(NOCc1ccccc1)C(=O)NP(=O)(O)OC[C@H]1C=C[C@@H](n2cnc3c(N)ncnc32)C1 |
| InChI | InChI=1S/C23H28N7O7P/c1-23(22(32)35-2,29-36-11-15-6-4-3-5-7-15)21(31)28-38(33,34)37-12-16-8-9-17(10-16)30-14-27-18-19(24)25-13-26-20(18)30/h3-9,13-14,16-17,29H,10-12H2,1-2H3,(H2,24,25,26)(H2,28,31,33,34)/t16-,17+,23-/m0/s1 |
| InChIKey | VMXGVTBUWRFCMP-MFEFFIJZSA-N |
| XLogP | 1.41 |
| TPSA | 192.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|