C23H30N7O5P — CID 21059642
[amino-[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy]phosphoryl] (2R)-2-(N-methoxyanilino)-3-methylbutanoate (PubChem CID 21059642) has the molecular formula C23H30N7O5P and a molecular weight of 515.51 g/mol. Its IUPAC name is [amino-[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy]phosphoryl] (2R)-2-(N-methoxyanilino)-3-methylbutanoate.
| Compound Name | [amino-[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy]phosphoryl] (2R)-2-(N-methoxyanilino)-3-methylbutanoate |
|---|---|
| PubChem CID | 21059642 |
| Molecular Formula | C23H30N7O5P |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | [amino-[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy]phosphoryl] (2R)-2-(N-methoxyanilino)-3-methylbutanoate |
| SMILES | CON(c1ccccc1)[C@@H](C(=O)OP(N)(=O)OC[C@H]1C=C[C@@H](n2cnc3c(N)ncnc32)C1)C(C)C |
| InChI | InChI=1S/C23H30N7O5P/c1-15(2)20(30(33-3)17-7-5-4-6-8-17)23(31)35-36(25,32)34-12-16-9-10-18(11-16)29-14-28-19-21(24)26-13-27-22(19)29/h4-10,13-16,18,20H,11-12H2,1-3H3,(H2,25,32)(H2,24,26,27)/t16-,18+,20+,36?/m0/s1 |
| InChIKey | LSJGSHNMAGEXEP-TXDHAOPUSA-N |
| XLogP | 3.24 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|