C28H36N7O6P — CID 20598647
[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] (2S)-2-(N-cyclopentyloxyanilino)propanoate (PubChem CID 20598647) has the molecular formula C28H36N7O6P and a molecular weight of 597.61 g/mol. Its IUPAC name is [[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] (2S)-2-(N-cyclopentyloxyanilino)propanoate.
| Compound Name | [[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] (2S)-2-(N-cyclopentyloxyanilino)propanoate |
|---|---|
| PubChem CID | 20598647 |
| Molecular Formula | C28H36N7O6P |
| Molecular Weight | 597.61 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | [[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-hydroxyphosphoryl] (2S)-2-(N-cyclopentyloxyanilino)propanoate |
| SMILES | C[C@@H](C(=O)OP(=O)(O)OC[C@@H]1C=C[C@H](n2cnc3c(NC4CC4)nc(N)nc32)C1)N(OC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C28H36N7O6P/c1-18(35(21-7-3-2-4-8-21)40-23-9-5-6-10-23)27(36)41-42(37,38)39-16-19-11-14-22(15-19)34-17-30-24-25(31-20-12-13-20)32-28(29)33-26(24)34/h2-4,7-8,11,14,17-20,22-23H,5-6,9-10,12-13,15-16H2,1H3,(H,37,38)(H3,29,31,32,33)/t18-,19+,22-/m0/s1 |
| InChIKey | BHOLYYRVIICGEL-JQVVWYNYSA-N |
| XLogP | 4.53 |
| TPSA | 166.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|