C15H20N6O3S — CID 124647264
2-[(1R,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]ethanesulfonic acid (PubChem CID 124647264) has the molecular formula C15H20N6O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-[(1R,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]ethanesulfonic acid.
| Compound Name | 2-[(1R,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 124647264 |
| Molecular Formula | C15H20N6O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-[(1R,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]ethanesulfonic acid |
| SMILES | Nc1nc(NC2CC2)c2ncn([C@@H]3C=C[C@@H](CCS(=O)(=O)O)C3)c2n1 |
| InChI | InChI=1S/C15H20N6O3S/c16-15-19-13(18-10-2-3-10)12-14(20-15)21(8-17-12)11-4-1-9(7-11)5-6-25(22,23)24/h1,4,8-11H,2-3,5-7H2,(H,22,23,24)(H3,16,18,19,20)/t9-,11+/m0/s1 |
| InChIKey | PWDJVZCMMSQJKM-GXSJLCMTSA-N |
| XLogP | 1.38 |
| TPSA | 136.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|