C19H28N6O — CID 18646157
[(1R,4S)-4-[2-amino-6-(cyclooctylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol (PubChem CID 18646157) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is [(1R,4S)-4-[2-amino-6-(cyclooctylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[2-amino-6-(cyclooctylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 18646157 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | [(1R,4S)-4-[2-amino-6-(cyclooctylamino)purin-9-yl]cyclopent-2-en-1-yl]methanol |
| SMILES | Nc1nc(NC2CCCCCCC2)c2ncn([C@@H]3C=C[C@H](CO)C3)c2n1 |
| InChI | InChI=1S/C19H28N6O/c20-19-23-17(22-14-6-4-2-1-3-5-7-14)16-18(24-19)25(12-21-16)15-9-8-13(10-15)11-26/h8-9,12-15,26H,1-7,10-11H2,(H3,20,22,23,24)/t13-,15+/m0/s1 |
| InChIKey | ACUUFFUBJQHESL-DZGCQCFKSA-N |
| XLogP | 3.04 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|