C37H48N12O4 — CID 102224483
bis[[(1R,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methyl] nonanedioate (PubChem CID 102224483) has the molecular formula C37H48N12O4 and a molecular weight of 724.87 g/mol. Its IUPAC name is bis[[(1R,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methyl] nonanedioate.
| Compound Name | bis[[(1R,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methyl] nonanedioate |
|---|---|
| PubChem CID | 102224483 |
| Molecular Formula | C37H48N12O4 |
| Molecular Weight | 724.87 g/mol |
| Exact Mass | 724.39 |
| IUPAC Name | bis[[(1R,4S)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methyl] nonanedioate |
| SMILES | Nc1nc(NC2CC2)c2ncn([C@@H]3C=C[C@H](COC(=O)CCCCCCCC(=O)OC[C@H]4C=C[C@@H](n5cnc6c(NC7CC7)nc(N)nc65)C4)C3)c2n1 |
| InChI | InChI=1S/C37H48N12O4/c38-36-44-32(42-24-10-11-24)30-34(46-36)48(20-40-30)26-14-8-22(16-26)18-52-28(50)6-4-2-1-3-5-7-29(51)53-19-23-9-15-27(17-23)49-21-41-31-33(43-25-12-13-25)45-37(39)47-35(31)49/h8-9,14-15,20-27H,1-7,10-13,16-19H2,(H3,38,42,44,46)(H3,39,43,45,47)/t22-,23-,26+,27+/m0/s1 |
| InChIKey | PWPAWKDESHZZDQ-KEKSMWEKSA-N |
| XLogP | 5.03 |
| TPSA | 215.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.87 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|