C13H14ClN5O3 — CID 10914291
[(1R,4S)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methyl methyl carbonate (PubChem CID 10914291) has the molecular formula C13H14ClN5O3 and a molecular weight of 323.74 g/mol. Its IUPAC name is [(1R,4S)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methyl methyl carbonate.
| Compound Name | [(1R,4S)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methyl methyl carbonate |
|---|---|
| PubChem CID | 10914291 |
| Molecular Formula | C13H14ClN5O3 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | [(1R,4S)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methyl methyl carbonate |
| SMILES | COC(=O)OC[C@H]1C=C[C@@H](n2cnc3c(Cl)nc(N)nc32)C1 |
| InChI | InChI=1S/C13H14ClN5O3/c1-21-13(20)22-5-7-2-3-8(4-7)19-6-16-9-10(14)17-12(15)18-11(9)19/h2-3,6-8H,4-5H2,1H3,(H2,15,17,18)/t7-,8+/m0/s1 |
| InChIKey | GTIUVRHTLMISKG-JGVFFNPUSA-N |
| XLogP | 1.96 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|