C23H28ClN6O5P — CID 174212985
2-[[[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]-propan-2-ylamino]propanoic acid (PubChem CID 174212985) has the molecular formula C23H28ClN6O5P and a molecular weight of 534.94 g/mol. Its IUPAC name is 2-[[[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]-propan-2-ylamino]propanoic acid.
| Compound Name | 2-[[[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 174212985 |
| Molecular Formula | C23H28ClN6O5P |
| Molecular Weight | 534.94 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 2-[[[(1S,4R)-4-(2-amino-6-chloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]-propan-2-ylamino]propanoic acid |
| SMILES | CC(C)N(C(C)C(=O)O)P(=O)(OC[C@@H]1C=C[C@H](n2cnc3c(Cl)nc(N)nc32)C1)Oc1ccccc1 |
| InChI | InChI=1S/C23H28ClN6O5P/c1-14(2)30(15(3)22(31)32)36(33,35-18-7-5-4-6-8-18)34-12-16-9-10-17(11-16)29-13-26-19-20(24)27-23(25)28-21(19)29/h4-10,13-17H,11-12H2,1-3H3,(H,31,32)(H2,25,27,28)/t15?,16-,17+,36?/m1/s1 |
| InChIKey | JZVDZZOMIULKRD-JYXXHTBLSA-N |
| XLogP | 4.57 |
| TPSA | 145.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.94 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|