C26H34N7O5P — CID 5496360
propan-2-yl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 5496360) has the molecular formula C26H34N7O5P and a molecular weight of 555.58 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 5496360 |
| Molecular Formula | C26H34N7O5P |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@@H]1C=C[C@H](n2cnc3c(NC4CC4)nc(N)nc32)C1)Oc1ccccc1 |
| InChI | InChI=1S/C26H34N7O5P/c1-16(2)37-25(34)17(3)32-39(35,38-21-7-5-4-6-8-21)36-14-18-9-12-20(13-18)33-15-28-22-23(29-19-10-11-19)30-26(27)31-24(22)33/h4-9,12,15-20H,10-11,13-14H2,1-3H3,(H,32,35)(H3,27,29,30,31)/t17-,18+,20-,39?/m0/s1 |
| InChIKey | ASFHVLLZAUHMHQ-HIXTZNJNSA-N |
| XLogP | 4.23 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|