C21H25N6O6P — CID 135997846
methyl 2-[[[4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 135997846) has the molecular formula C21H25N6O6P and a molecular weight of 488.44 g/mol. Its IUPAC name is methyl 2-[[[4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl 2-[[[4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 135997846 |
| Molecular Formula | C21H25N6O6P |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | methyl 2-[[[4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)C(C)NP(=O)(OCC1C=CC(n2cnc3c(=O)[nH]c(N)nc32)C1)Oc1ccccc1 |
| InChI | InChI=1S/C21H25N6O6P/c1-13(20(29)31-2)26-34(30,33-16-6-4-3-5-7-16)32-11-14-8-9-15(10-14)27-12-23-17-18(27)24-21(22)25-19(17)28/h3-9,12-15H,10-11H2,1-2H3,(H,26,30)(H3,22,24,25,28) |
| InChIKey | YJSZTDICLWYXNV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 163.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|