C27H36N7O5P — CID 5496362
2-methylpropyl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 5496362) has the molecular formula C27H36N7O5P and a molecular weight of 569.60 g/mol. Its IUPAC name is 2-methylpropyl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 2-methylpropyl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 5496362 |
| Molecular Formula | C27H36N7O5P |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 2-methylpropyl (2S)-2-[[[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)COC(=O)[C@H](C)NP(=O)(OC[C@@H]1C=C[C@H](n2cnc3c(NC4CC4)nc(N)nc32)C1)Oc1ccccc1 |
| InChI | InChI=1S/C27H36N7O5P/c1-17(2)14-37-26(35)18(3)33-40(36,39-22-7-5-4-6-8-22)38-15-19-9-12-21(13-19)34-16-29-23-24(30-20-10-11-20)31-27(28)32-25(23)34/h4-9,12,16-21H,10-11,13-15H2,1-3H3,(H,33,36)(H3,28,30,31,32)/t18-,19+,21-,40?/m0/s1 |
| InChIKey | ZTZVJRINCNZRIM-NIIJZQCQSA-N |
| XLogP | 4.48 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|