C24H28ClN6O6P — CID 156758253
cyclopropyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate (PubChem CID 156758253) has the molecular formula C24H28ClN6O6P and a molecular weight of 562.95 g/mol. Its IUPAC name is cyclopropyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | cyclopropyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156758253 |
| Molecular Formula | C24H28ClN6O6P |
| Molecular Weight | 562.95 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | cyclopropyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
| SMILES | COc1nc(N)nc2c1ncn2[C@H]1C=C[C@@H](COP(=O)(N[C@@H](C)C(=O)OC2CC2)Oc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H28ClN6O6P/c1-14(23(32)36-18-9-10-18)30-38(33,37-19-7-4-16(25)5-8-19)35-12-15-3-6-17(11-15)31-13-27-20-21(31)28-24(26)29-22(20)34-2/h3-8,13-15,17-18H,9-12H2,1-2H3,(H,30,33)(H2,26,28,29)/t14-,15+,17-,38?/m0/s1 |
| InChIKey | KCWHIBNKGXKHEO-QLAZVMQGSA-N |
| XLogP | 4.08 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.95 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|