C24H30ClN6O6P — CID 174211705
2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-chlorophenoxy)phosphoryl]-propan-2-ylamino]propanoic acid (PubChem CID 174211705) has the molecular formula C24H30ClN6O6P and a molecular weight of 564.97 g/mol. Its IUPAC name is 2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-chlorophenoxy)phosphoryl]-propan-2-ylamino]propanoic acid.
| Compound Name | 2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-chlorophenoxy)phosphoryl]-propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 174211705 |
| Molecular Formula | C24H30ClN6O6P |
| Molecular Weight | 564.97 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-(4-chlorophenoxy)phosphoryl]-propan-2-ylamino]propanoic acid |
| SMILES | COc1nc(N)nc2c1ncn2[C@H]1C=C[C@@H](COP(=O)(Oc2ccc(Cl)cc2)N(C(C)C)C(C)C(=O)O)C1 |
| InChI | InChI=1S/C24H30ClN6O6P/c1-14(2)31(15(3)23(32)33)38(34,37-19-9-6-17(25)7-10-19)36-12-16-5-8-18(11-16)30-13-27-20-21(30)28-24(26)29-22(20)35-4/h5-10,13-16,18H,11-12H2,1-4H3,(H,32,33)(H2,26,28,29)/t15?,16-,18+,38?/m1/s1 |
| InChIKey | YHYVFHXNSGNXFS-QQJGSFNMSA-N |
| XLogP | 4.57 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.97 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|