C22H28BrN6O6P — CID 156758297
methyl (2S)-2-[[[3-(2-amino-6-methoxypurin-9-yl)cyclobutyl]methoxy-(4-bromophenoxy)phosphoryl]-methylamino]propanoate (PubChem CID 156758297) has the molecular formula C22H28BrN6O6P and a molecular weight of 583.38 g/mol. Its IUPAC name is methyl (2S)-2-[[[3-(2-amino-6-methoxypurin-9-yl)cyclobutyl]methoxy-(4-bromophenoxy)phosphoryl]-methylamino]propanoate.
| Compound Name | methyl (2S)-2-[[[3-(2-amino-6-methoxypurin-9-yl)cyclobutyl]methoxy-(4-bromophenoxy)phosphoryl]-methylamino]propanoate |
|---|---|
| PubChem CID | 156758297 |
| Molecular Formula | C22H28BrN6O6P |
| Molecular Weight | 583.38 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | methyl (2S)-2-[[[3-(2-amino-6-methoxypurin-9-yl)cyclobutyl]methoxy-(4-bromophenoxy)phosphoryl]-methylamino]propanoate |
| SMILES | COC(=O)[C@H](C)N(C)P(=O)(OCC1CC(n2cnc3c(OC)nc(N)nc32)C1)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H28BrN6O6P/c1-13(21(30)33-4)28(2)36(31,35-17-7-5-15(23)6-8-17)34-11-14-9-16(10-14)29-12-25-18-19(29)26-22(24)27-20(18)32-3/h5-8,12-14,16H,9-11H2,1-4H3,(H2,24,26,27)/t13-,14?,16?,36?/m0/s1 |
| InChIKey | WUEZYOXJQXFWRT-JAVFBFTASA-N |
| XLogP | 3.83 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|