C21H27N6O8P — CID 57345285
ethyl (2S)-2-[[[(2R,4R)-4-(2-amino-6-methoxypurin-9-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 57345285) has the molecular formula C21H27N6O8P and a molecular weight of 522.46 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,4R)-4-(2-amino-6-methoxypurin-9-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,4R)-4-(2-amino-6-methoxypurin-9-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 57345285 |
| Molecular Formula | C21H27N6O8P |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,4R)-4-(2-amino-6-methoxypurin-9-yl)-1,3-dioxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@@H]1OC[C@H](n2cnc3c(OC)nc(N)nc32)O1)Oc1ccccc1 |
| InChI | InChI=1S/C21H27N6O8P/c1-4-31-20(28)13(2)26-36(29,35-14-8-6-5-7-9-14)33-11-16-32-10-15(34-16)27-12-23-17-18(27)24-21(22)25-19(17)30-3/h5-9,12-13,15-16H,4,10-11H2,1-3H3,(H,26,29)(H2,22,24,25)/t13-,15+,16+,36?/m0/s1 |
| InChIKey | BXKIDELGUHDBHT-ITESKNJQSA-N |
| XLogP | 2.03 |
| TPSA | 171.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|