C22H27N6O6P — CID 153397037
methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 153397037) has the molecular formula C22H27N6O6P and a molecular weight of 502.47 g/mol. Its IUPAC name is methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 153397037 |
| Molecular Formula | C22H27N6O6P |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | methyl (2S)-2-[[[(1S,4R)-4-(2-amino-6-methoxypurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OC[C@@H]1C=C[C@H](n2cnc3c(OC)nc(N)nc32)C1)Oc1ccccc1 |
| InChI | InChI=1S/C22H27N6O6P/c1-14(21(29)32-3)27-35(30,34-17-7-5-4-6-8-17)33-12-15-9-10-16(11-15)28-13-24-18-19(28)25-22(23)26-20(18)31-2/h4-10,13-16H,11-12H2,1-3H3,(H,27,30)(H2,23,25,26)/t14-,15+,16-,35?/m0/s1 |
| InChIKey | JMFRNXZAUCVFJI-HSXLERTDSA-N |
| XLogP | 2.89 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|