C20H20Cl2N5O5P — CID 174189345
2-[[[(1S,4R)-4-(2,6-dichloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid (PubChem CID 174189345) has the molecular formula C20H20Cl2N5O5P and a molecular weight of 512.29 g/mol. Its IUPAC name is 2-[[[(1S,4R)-4-(2,6-dichloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid.
| Compound Name | 2-[[[(1S,4R)-4-(2,6-dichloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 174189345 |
| Molecular Formula | C20H20Cl2N5O5P |
| Molecular Weight | 512.29 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 2-[[[(1S,4R)-4-(2,6-dichloropurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoic acid |
| SMILES | CC(NP(=O)(OC[C@@H]1C=C[C@H](n2cnc3c(Cl)nc(Cl)nc32)C1)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H20Cl2N5O5P/c1-12(19(28)29)26-33(30,32-15-5-3-2-4-6-15)31-10-13-7-8-14(9-13)27-11-23-16-17(21)24-20(22)25-18(16)27/h2-8,11-14H,9-10H2,1H3,(H,26,30)(H,28,29)/t12?,13-,14+,33?/m1/s1 |
| InChIKey | SBTLRQOUHGDZJV-OJYGYGHOSA-N |
| XLogP | 4.52 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.29 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|