C24H27N6O6P — CID 153397095
methyl (2S)-2-[[[3-(2-amino-6-oxo-1H-purin-9-yl)cyclobutyl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 153397095) has the molecular formula C24H27N6O6P and a molecular weight of 526.49 g/mol. Its IUPAC name is methyl (2S)-2-[[[3-(2-amino-6-oxo-1H-purin-9-yl)cyclobutyl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[3-(2-amino-6-oxo-1H-purin-9-yl)cyclobutyl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 153397095 |
| Molecular Formula | C24H27N6O6P |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | methyl (2S)-2-[[[3-(2-amino-6-oxo-1H-purin-9-yl)cyclobutyl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OCC1CC(n2cnc3c(=O)[nH]c(N)nc32)C1)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C24H27N6O6P/c1-14(23(32)34-2)29-37(33,36-19-9-5-7-16-6-3-4-8-18(16)19)35-12-15-10-17(11-15)30-13-26-20-21(30)27-24(25)28-22(20)31/h3-9,13-15,17H,10-12H2,1-2H3,(H,29,33)(H3,25,27,28,31)/t14-,15?,17?,37?/m0/s1 |
| InChIKey | SDAAZLWIRFDOET-SRYSYRCBSA-N |
| XLogP | 3.16 |
| TPSA | 163.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|