C21H26BrN6O6P — CID 153397084
methyl (2S)-2-[[[3-(2-amino-6-methoxypurin-9-yl)cyclobutyl]methoxy-(2-bromophenoxy)phosphoryl]amino]propanoate (PubChem CID 153397084) has the molecular formula C21H26BrN6O6P and a molecular weight of 569.35 g/mol. Its IUPAC name is methyl (2S)-2-[[[3-(2-amino-6-methoxypurin-9-yl)cyclobutyl]methoxy-(2-bromophenoxy)phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[3-(2-amino-6-methoxypurin-9-yl)cyclobutyl]methoxy-(2-bromophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 153397084 |
| Molecular Formula | C21H26BrN6O6P |
| Molecular Weight | 569.35 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | methyl (2S)-2-[[[3-(2-amino-6-methoxypurin-9-yl)cyclobutyl]methoxy-(2-bromophenoxy)phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(OCC1CC(n2cnc3c(OC)nc(N)nc32)C1)Oc1ccccc1Br |
| InChI | InChI=1S/C21H26BrN6O6P/c1-12(20(29)32-3)27-35(30,34-16-7-5-4-6-15(16)22)33-10-13-8-14(9-13)28-11-24-17-18(28)25-21(23)26-19(17)31-2/h4-7,11-14H,8-10H2,1-3H3,(H,27,30)(H2,23,25,26)/t12-,13?,14?,35?/m0/s1 |
| InChIKey | BPDIASFGJNUTER-VOHUREDLSA-N |
| XLogP | 3.49 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|