C25H31N6O7P — CID 135908406
tert-butyl (2S)-2-[[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 135908406) has the molecular formula C25H31N6O7P and a molecular weight of 558.53 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | tert-butyl (2S)-2-[[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 135908406 |
| Molecular Formula | C25H31N6O7P |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | tert-butyl (2S)-2-[[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OCCOCn1cnc2c(=O)[nH]c(N)nc21)Oc1cccc2ccccc12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H31N6O7P/c1-16(23(33)37-25(2,3)4)30-39(34,38-19-11-7-9-17-8-5-6-10-18(17)19)36-13-12-35-15-31-14-27-20-21(31)28-24(26)29-22(20)32/h5-11,14,16H,12-13,15H2,1-4H3,(H,30,34)(H3,26,28,29,32)/t16-,39?/m0/s1 |
| InChIKey | OXCHWFRVSIWROP-CRMMKSMKSA-N |
| XLogP | 3.35 |
| TPSA | 172.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|