C23H25N6O7P — CID 135908430
benzyl 2-[[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-phenoxyphosphoryl]amino]acetate (PubChem CID 135908430) has the molecular formula C23H25N6O7P and a molecular weight of 528.46 g/mol. Its IUPAC name is benzyl 2-[[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-phenoxyphosphoryl]amino]acetate.
| Compound Name | benzyl 2-[[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-phenoxyphosphoryl]amino]acetate |
|---|---|
| PubChem CID | 135908430 |
| Molecular Formula | C23H25N6O7P |
| Molecular Weight | 528.46 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | benzyl 2-[[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethoxy-phenoxyphosphoryl]amino]acetate |
| SMILES | Nc1nc2c(ncn2COCCOP(=O)(NCC(=O)OCc2ccccc2)Oc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C23H25N6O7P/c24-23-27-21-20(22(31)28-23)25-15-29(21)16-33-11-12-35-37(32,36-18-9-5-2-6-10-18)26-13-19(30)34-14-17-7-3-1-4-8-17/h1-10,15H,11-14,16H2,(H,26,32)(H3,24,27,28,31) |
| InChIKey | DESPFOBOLFEBTB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 172.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|