C30H38N7O7P — CID 135908448
benzyl (2S)-2-[[2-[[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]methoxy]ethoxy-phenoxyphosphoryl]amino]-4-methylpentanoate (PubChem CID 135908448) has the molecular formula C30H38N7O7P and a molecular weight of 639.65 g/mol. Its IUPAC name is benzyl (2S)-2-[[2-[[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]methoxy]ethoxy-phenoxyphosphoryl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[2-[[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]methoxy]ethoxy-phenoxyphosphoryl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 135908448 |
| Molecular Formula | C30H38N7O7P |
| Molecular Weight | 639.65 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | benzyl (2S)-2-[[2-[[2-[(E)-dimethylaminomethylideneamino]-6-oxo-1H-purin-9-yl]methoxy]ethoxy-phenoxyphosphoryl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NP(=O)(OCCOCn1cnc2c(=O)[nH]c(/N=C/N(C)C)nc21)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H38N7O7P/c1-22(2)17-25(29(39)42-18-23-11-7-5-8-12-23)35-45(40,44-24-13-9-6-10-14-24)43-16-15-41-21-37-20-31-26-27(37)33-30(34-28(26)38)32-19-36(3)4/h5-14,19-20,22,25H,15-18,21H2,1-4H3,(H,35,40)(H,33,34,38)/b32-19+/t25-,45?/m0/s1 |
| InChIKey | FASYGIHFGXMLRK-JQVXRKSESA-N |
| XLogP | 4.27 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|