C11H16N6O — CID 136968646
N,N-dimethyl-N'-(6-oxo-9-propan-2-yl-1H-purin-2-yl)methanimidamide (PubChem CID 136968646) has the molecular formula C11H16N6O and a molecular weight of 248.29 g/mol. Its IUPAC name is N,N-dimethyl-N'-(6-oxo-9-propan-2-yl-1H-purin-2-yl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(6-oxo-9-propan-2-yl-1H-purin-2-yl)methanimidamide |
|---|---|
| PubChem CID | 136968646 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | N,N-dimethyl-N'-(6-oxo-9-propan-2-yl-1H-purin-2-yl)methanimidamide |
| SMILES | CC(C)n1cnc2c(=O)[nH]c(/N=C\N(C)C)nc21 |
| InChI | InChI=1S/C11H16N6O/c1-7(2)17-6-12-8-9(17)14-11(15-10(8)18)13-5-16(3)4/h5-7H,1-4H3,(H,14,15,18)/b13-5- |
| InChIKey | LWNOPXPKMUBYPG-ACAGNQJTSA-N |
| XLogP | 0.92 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|