C12H18N6O — CID 177315695
N'-(9-butyl-6-oxo-1H-purin-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 177315695) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is N'-(9-butyl-6-oxo-1H-purin-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(9-butyl-6-oxo-1H-purin-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 177315695 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N'-(9-butyl-6-oxo-1H-purin-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CCCCn1cnc2c(=O)[nH]c(/N=C/N(C)C)nc21 |
| InChI | InChI=1S/C12H18N6O/c1-4-5-6-18-8-13-9-10(18)15-12(16-11(9)19)14-7-17(2)3/h7-8H,4-6H2,1-3H3,(H,15,16,19)/b14-7+ |
| InChIKey | YBKDYBNJOSJZLL-VGOFMYFVSA-N |
| XLogP | 1.14 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|