C32H34N6O5 — CID 135870711
N'-[9-[(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 135870711) has the molecular formula C32H34N6O5 and a molecular weight of 582.66 g/mol. Its IUPAC name is N'-[9-[(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 135870711 |
| Molecular Formula | C32H34N6O5 |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | N'-[9-[(2S)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | COc1ccc(C(OC[C@@H](O)Cn2cnc3c(=O)[nH]c(/N=C/N(C)C)nc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H34N6O5/c1-37(2)20-34-31-35-29-28(30(40)36-31)33-21-38(29)18-25(39)19-43-32(22-8-6-5-7-9-22,23-10-14-26(41-3)15-11-23)24-12-16-27(42-4)17-13-24/h5-17,20-21,25,39H,18-19H2,1-4H3,(H,35,36,40)/b34-20+/t25-/m0/s1 |
| InChIKey | YEFYMGCKAYHKRG-APNLOGHKSA-N |
| XLogP | 3.73 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|