C31H31N5O5 — CID 170699597
N-[9-[(2S)-2-hydroxy-4,4-bis(4-methoxyphenyl)-4-phenylbutyl]-6-oxo-1H-purin-2-yl]acetamide (PubChem CID 170699597) has the molecular formula C31H31N5O5 and a molecular weight of 553.62 g/mol. Its IUPAC name is N-[9-[(2S)-2-hydroxy-4,4-bis(4-methoxyphenyl)-4-phenylbutyl]-6-oxo-1H-purin-2-yl]acetamide.
| Compound Name | N-[9-[(2S)-2-hydroxy-4,4-bis(4-methoxyphenyl)-4-phenylbutyl]-6-oxo-1H-purin-2-yl]acetamide |
|---|---|
| PubChem CID | 170699597 |
| Molecular Formula | C31H31N5O5 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | N-[9-[(2S)-2-hydroxy-4,4-bis(4-methoxyphenyl)-4-phenylbutyl]-6-oxo-1H-purin-2-yl]acetamide |
| SMILES | COc1ccc(C(C[C@H](O)Cn2cnc3c(=O)[nH]c(NC(C)=O)nc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H31N5O5/c1-20(37)33-30-34-28-27(29(39)35-30)32-19-36(28)18-24(38)17-31(21-7-5-4-6-8-21,22-9-13-25(40-2)14-10-22)23-11-15-26(41-3)16-12-23/h4-16,19,24,38H,17-18H2,1-3H3,(H2,33,34,35,37,39)/t24-/m0/s1 |
| InChIKey | DZFMMTDZQMUEET-DEOSSOPVSA-N |
| XLogP | 3.88 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|