C36H41N7O6 — CID 136674942
2-[2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]ethyl-[2-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid (PubChem CID 136674942) has the molecular formula C36H41N7O6 and a molecular weight of 667.77 g/mol. Its IUPAC name is 2-[2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]ethyl-[2-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]ethyl-[2-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 136674942 |
| Molecular Formula | C36H41N7O6 |
| Molecular Weight | 667.77 g/mol |
| Exact Mass | 667.31 |
| IUPAC Name | 2-[2-[[bis(4-methoxyphenyl)-phenylmethyl]amino]ethyl-[2-[2-(2-methylpropylamino)-6-oxo-1H-purin-9-yl]acetyl]amino]acetic acid |
| SMILES | COc1ccc(C(NCCN(CC(=O)O)C(=O)Cn2cnc3c(=O)[nH]c(NCC(C)C)nc32)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H41N7O6/c1-24(2)20-37-35-40-33-32(34(47)41-35)38-23-43(33)21-30(44)42(22-31(45)46)19-18-39-36(25-8-6-5-7-9-25,26-10-14-28(48-3)15-11-26)27-12-16-29(49-4)17-13-27/h5-17,23-24,39H,18-22H2,1-4H3,(H,45,46)(H2,37,40,41,47) |
| InChIKey | BJGLBSHULPWKIG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 163.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|