C30H30N4O6 — CID 10940516
2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl]amino]acetic acid (PubChem CID 10940516) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is 2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 10940516 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 2-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl]amino]acetic acid |
| SMILES | COc1ccc(C(NCCN(CC(=O)O)C(=O)Cn2ccc(=O)[nH]c2=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N4O6/c1-40-25-14-12-24(13-15-25)30(22-8-4-2-5-9-22,23-10-6-3-7-11-23)31-17-19-33(21-28(37)38)27(36)20-34-18-16-26(35)32-29(34)39/h2-16,18,31H,17,19-21H2,1H3,(H,37,38)(H,32,35,39) |
| InChIKey | BYBTWCBJFHJIIG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|