C29H29N5O6 — CID 57067245
2-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl-[2-(1-nitroimidazol-2-yl)acetyl]amino]acetic acid (PubChem CID 57067245) has the molecular formula C29H29N5O6 and a molecular weight of 543.58 g/mol. Its IUPAC name is 2-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl-[2-(1-nitroimidazol-2-yl)acetyl]amino]acetic acid.
| Compound Name | 2-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl-[2-(1-nitroimidazol-2-yl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 57067245 |
| Molecular Formula | C29H29N5O6 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 2-[2-[[(4-methoxyphenyl)-diphenylmethyl]amino]ethyl-[2-(1-nitroimidazol-2-yl)acetyl]amino]acetic acid |
| SMILES | COc1ccc(C(NCCN(CC(=O)O)C(=O)Cc2nccn2[N+](=O)[O-])(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H29N5O6/c1-40-25-14-12-24(13-15-25)29(22-8-4-2-5-9-22,23-10-6-3-7-11-23)31-17-18-32(21-28(36)37)27(35)20-26-30-16-19-33(26)34(38)39/h2-16,19,31H,17-18,20-21H2,1H3,(H,36,37) |
| InChIKey | CJNGFWOEUUNVGB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|