C28H27NO2 — CID 11795851
N-benzyl-1,1-bis(4-methoxyphenyl)-1-phenylmethan(15N)amine (PubChem CID 11795851) has the molecular formula C28H27NO2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-benzyl-1,1-bis(4-methoxyphenyl)-1-phenylmethan(15N)amine.
| Compound Name | N-benzyl-1,1-bis(4-methoxyphenyl)-1-phenylmethan(15N)amine |
|---|---|
| PubChem CID | 11795851 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-benzyl-1,1-bis(4-methoxyphenyl)-1-phenylmethan(15N)amine |
| SMILES | COc1ccc(C([15NH]Cc2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H27NO2/c1-30-26-17-13-24(14-18-26)28(23-11-7-4-8-12-23,25-15-19-27(31-2)20-16-25)29-21-22-9-5-3-6-10-22/h3-20,29H,21H2,1-2H3/i29+1 |
| InChIKey | QVNWEKQTMMCALW-HFZKCAFASA-N |
| XLogP | 5.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|