C27H33NO4 — CID 101065100
6-[[bis(4-methoxyphenyl)-phenylmethyl]amino]oxyhexan-1-ol (PubChem CID 101065100) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 6-[[bis(4-methoxyphenyl)-phenylmethyl]amino]oxyhexan-1-ol.
| Compound Name | 6-[[bis(4-methoxyphenyl)-phenylmethyl]amino]oxyhexan-1-ol |
|---|---|
| PubChem CID | 101065100 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 6-[[bis(4-methoxyphenyl)-phenylmethyl]amino]oxyhexan-1-ol |
| SMILES | COc1ccc(C(NOCCCCCCO)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H33NO4/c1-30-25-16-12-23(13-17-25)27(22-10-6-5-7-11-22,24-14-18-26(31-2)19-15-24)28-32-21-9-4-3-8-20-29/h5-7,10-19,28-29H,3-4,8-9,20-21H2,1-2H3 |
| InChIKey | QFFYVDRIMDCGKE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|