C27H35NO2 — CID 163823196
6-[[(4-methoxyphenyl)-(6-methylcyclohexa-2,4-dien-1-yl)-phenylmethyl]amino]hexan-1-ol (PubChem CID 163823196) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is 6-[[(4-methoxyphenyl)-(6-methylcyclohexa-2,4-dien-1-yl)-phenylmethyl]amino]hexan-1-ol.
| Compound Name | 6-[[(4-methoxyphenyl)-(6-methylcyclohexa-2,4-dien-1-yl)-phenylmethyl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 163823196 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 6-[[(4-methoxyphenyl)-(6-methylcyclohexa-2,4-dien-1-yl)-phenylmethyl]amino]hexan-1-ol |
| SMILES | COc1ccc(C(NCCCCCCO)(c2ccccc2)C2C=CC=CC2C)cc1 |
| InChI | InChI=1S/C27H35NO2/c1-22-12-8-9-15-26(22)27(23-13-6-5-7-14-23,28-20-10-3-4-11-21-29)24-16-18-25(30-2)19-17-24/h5-9,12-19,22,26,28-29H,3-4,10-11,20-21H2,1-2H3 |
| InChIKey | NXEQPJAPMJTPQP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|