C34H44N2O7 — CID 15218076
4-[3-[2-[2-[3-[[(4-methoxyphenyl)-diphenylmethyl]amino]propoxy]ethoxy]ethoxy]propylamino]-4-oxobutanoic acid (PubChem CID 15218076) has the molecular formula C34H44N2O7 and a molecular weight of 592.73 g/mol. Its IUPAC name is 4-[3-[2-[2-[3-[[(4-methoxyphenyl)-diphenylmethyl]amino]propoxy]ethoxy]ethoxy]propylamino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[2-[2-[3-[[(4-methoxyphenyl)-diphenylmethyl]amino]propoxy]ethoxy]ethoxy]propylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 15218076 |
| Molecular Formula | C34H44N2O7 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.31 |
| IUPAC Name | 4-[3-[2-[2-[3-[[(4-methoxyphenyl)-diphenylmethyl]amino]propoxy]ethoxy]ethoxy]propylamino]-4-oxobutanoic acid |
| SMILES | COc1ccc(C(NCCCOCCOCCOCCCNC(=O)CCC(=O)O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H44N2O7/c1-40-31-16-14-30(15-17-31)34(28-10-4-2-5-11-28,29-12-6-3-7-13-29)36-21-9-23-42-25-27-43-26-24-41-22-8-20-35-32(37)18-19-33(38)39/h2-7,10-17,36H,8-9,18-27H2,1H3,(H,35,37)(H,38,39) |
| InChIKey | MSQZIJBYSYUFRZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|