C44H45N3O6 — CID 130470206
3-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanoyl]amino]propanoic acid (PubChem CID 130470206) has the molecular formula C44H45N3O6 and a molecular weight of 711.86 g/mol. Its IUPAC name is 3-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 130470206 |
| Molecular Formula | C44H45N3O6 |
| Molecular Weight | 711.86 g/mol |
| Exact Mass | 711.33 |
| IUPAC Name | 3-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[[(4-methoxyphenyl)-diphenylmethyl]amino]hexanoyl]amino]propanoic acid |
| SMILES | COc1ccc(C(NCCCC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)NCCC(=O)O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H45N3O6/c1-52-34-25-23-33(24-26-34)44(31-14-4-2-5-15-31,32-16-6-3-7-17-32)46-28-13-12-22-40(42(50)45-29-27-41(48)49)47-43(51)53-30-39-37-20-10-8-18-35(37)36-19-9-11-21-38(36)39/h2-11,14-21,23-26,39-40,46H,12-13,22,27-30H2,1H3,(H,45,50)(H,47,51)(H,48,49)/t40-/m0/s1 |
| InChIKey | KFGUSQDUPLTWIF-FAIXQHPJSA-N |
| XLogP | 7.25 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.86 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|