C46H49N3O5 — CID 177208083
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid (PubChem CID 177208083) has the molecular formula C46H49N3O5 and a molecular weight of 723.91 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 177208083 |
| Molecular Formula | C46H49N3O5 |
| Molecular Weight | 723.91 g/mol |
| Exact Mass | 723.37 |
| IUPAC Name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]-6-[[(4-methylphenyl)-diphenylmethyl]amino]hexanoic acid |
| SMILES | Cc1ccc(C(NCCCC[C@H](NC(=O)[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(C)C)C(=O)O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H49N3O5/c1-31(2)42(49-45(53)54-30-40-38-22-12-10-20-36(38)37-21-11-13-23-39(37)40)43(50)48-41(44(51)52)24-14-15-29-47-46(33-16-6-4-7-17-33,34-18-8-5-9-19-34)35-27-25-32(3)26-28-35/h4-13,16-23,25-28,31,40-42,47H,14-15,24,29-30H2,1-3H3,(H,48,50)(H,49,53)(H,51,52)/t41-,42-/m0/s1 |
| InChIKey | KJJVUJQQBADXJU-COCZKOEFSA-N |
| XLogP | 8.18 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.91 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|