C41H42N2O5 — CID 123134718
(2S)-6-[[cyclohexa-1,3-dien-1-yl-(4-methoxyphenyl)-phenylmethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (PubChem CID 123134718) has the molecular formula C41H42N2O5 and a molecular weight of 642.80 g/mol. Its IUPAC name is (2S)-6-[[cyclohexa-1,3-dien-1-yl-(4-methoxyphenyl)-phenylmethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-6-[[cyclohexa-1,3-dien-1-yl-(4-methoxyphenyl)-phenylmethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 123134718 |
| Molecular Formula | C41H42N2O5 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | (2S)-6-[[cyclohexa-1,3-dien-1-yl-(4-methoxyphenyl)-phenylmethyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| SMILES | COc1ccc(C(NCCCC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)(C2=CC=CCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H42N2O5/c1-47-32-25-23-31(24-26-32)41(29-14-4-2-5-15-29,30-16-6-3-7-17-30)42-27-13-12-22-38(39(44)45)43-40(46)48-28-37-35-20-10-8-18-33(35)34-19-9-11-21-36(34)37/h2-6,8-11,14-16,18-21,23-26,37-38,42H,7,12-13,17,22,27-28H2,1H3,(H,43,46)(H,44,45)/t38-,41?/m0/s1 |
| InChIKey | NULDGXQMULVWIE-OTKZQKHGSA-N |
| XLogP | 7.97 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|