C39H37N3O3 — CID 163342980
9H-fluoren-9-ylmethyl N-[(2S)-1-amino-4-[[(4-methylphenyl)-diphenylmethyl]amino]-1-oxobutan-2-yl]carbamate (PubChem CID 163342980) has the molecular formula C39H37N3O3 and a molecular weight of 595.74 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-amino-4-[[(4-methylphenyl)-diphenylmethyl]amino]-1-oxobutan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-amino-4-[[(4-methylphenyl)-diphenylmethyl]amino]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 163342980 |
| Molecular Formula | C39H37N3O3 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.28 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-amino-4-[[(4-methylphenyl)-diphenylmethyl]amino]-1-oxobutan-2-yl]carbamate |
| SMILES | Cc1ccc(C(NCC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(N)=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H37N3O3/c1-27-20-22-30(23-21-27)39(28-12-4-2-5-13-28,29-14-6-3-7-15-29)41-25-24-36(37(40)43)42-38(44)45-26-35-33-18-10-8-16-31(33)32-17-9-11-19-34(32)35/h2-23,35-36,41H,24-26H2,1H3,(H2,40,43)(H,42,44)/t36-/m0/s1 |
| InChIKey | AIVSVTFSBHHOCB-BHVANESWSA-N |
| XLogP | 6.66 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|